H3 receptor-MO-1 structure
|
Common Name | H3 receptor-MO-1 | ||
|---|---|---|---|---|
| CAS Number | 1240914-03-7 | Molecular Weight | 341.45 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H27N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H3 receptor-MO-1H3 receptor-MO-1 is a modulator of histamine H3 receptor. |
| Name | H3 receptor-MO-1 |
|---|
| Description | H3 receptor-MO-1 is a modulator of histamine H3 receptor. |
|---|---|
| Related Catalog | |
| References |
[1]. Solid Forms Comprising A Cyclopropyl Amide Derivative. US 20110201622 A1 |
| Molecular Formula | C20H27N3O2 |
|---|---|
| Molecular Weight | 341.45 |
| InChIKey | NJJBLDDRYMCIMQ-XWIAVFTESA-N |
| SMILES | CC1CN(C2CCC2)CCN1C(=O)C1CC1c1ccc(C(N)=O)cc1 |