Hydroquinine, 2a(2)-(2-diethylaminoethoxy)
Modify Date: 2026-07-23 16:41:21
Hydroquinine, 2a(2)-(2-diethylaminoethoxy) structure
|
Common Name | Hydroquinine, 2a(2)-(2-diethylaminoethoxy) | ||
|---|---|---|---|---|
| CAS Number | 124136-56-7 | Molecular Weight | 441.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H39N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Hydroquinine, 2a(2)-(2-diethylaminoethoxy) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H39N3O3 |
|---|---|
| Molecular Weight | 441.6 |
| InChIKey | MCZDZWWSDOPIDX-QGHKNZBBSA-N |
| SMILES | CCC1CN2CCC1CC2C(O)c1cc(OCCN(CC)CC)nc2ccc(OC)cc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Hydroquinine, 2a(2)-(2-diethylaminoethoxy)? |
| A: The English name of Hydroquinine, 2a(2)-(2-diethylaminoethoxy) is Hydroquinine, 2a(2)-(2-diethylaminoethoxy). |
| Q: What is the Chinese name of 124136-56-7? |
| A: Chinese name of 124136-56-7 is 124136-56-7. |
| Q: What is the CAS number of Hydroquinine, 2a(2)-(2-diethylaminoethoxy)? |
| A: CAS number of Hydroquinine, 2a(2)-(2-diethylaminoethoxy) is 124136-56-7. |
| Q: What is the InChIKey of Hydroquinine, 2a(2)-(2-diethylaminoethoxy)? |
| A: InChIKey of Hydroquinine, 2a(2)-(2-diethylaminoethoxy) is MCZDZWWSDOPIDX-QGHKNZBBSA-N. |
| Q: What is the molecular weight of Hydroquinine, 2a(2)-(2-diethylaminoethoxy)? |
| A: Molecular weight of Hydroquinine, 2a(2)-(2-diethylaminoethoxy) is 441.6. |
| Q: What is the molecular formula of Hydroquinine, 2a(2)-(2-diethylaminoethoxy)? |
| A: Molecular formula of Hydroquinine, 2a(2)-(2-diethylaminoethoxy) is C26H39N3O3. |
| Q: What is the SMILES notation of Hydroquinine, 2a(2)-(2-diethylaminoethoxy)? |
| A: SMILES notation of Hydroquinine, 2a(2)-(2-diethylaminoethoxy) is CCC1CN2CCC1CC2C(O)c1cc(OCCN(CC)CC)nc2ccc(OC)cc12. |