4-Azido-D-phenylalanine
Modify Date: 2025-08-26 14:54:07
4-Azido-D-phenylalanine structure
|
Common Name | 4-Azido-D-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 1241681-80-0 | Molecular Weight | 206.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4-Azido-D-phenylalanine4-Azido-D-phenylalanine, a derivative of phenylalanine, is a benchmark reagent, and can be used in the synthesis of compounds[1]. |
| Name | 4-Azido-D-phenylalanine |
|---|
| Description | 4-Azido-D-phenylalanine, a derivative of phenylalanine, is a benchmark reagent, and can be used in the synthesis of compounds[1]. |
|---|---|
| Related Catalog | |
| Target |
GPR40[1] |
| References |
| Molecular Formula | C9H10N4O2 |
|---|---|
| Molecular Weight | 206.20 |
| InChIKey | NEMHIKRLROONTL-MRVPVSSYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc(CC(N)C(=O)O)cc1 |