2,5-dihydroxy-3-(4-nitrophenyl)-6-phenylcyclohexa-2,5-diene-1,4-dione structure
|
Common Name | 2,5-dihydroxy-3-(4-nitrophenyl)-6-phenylcyclohexa-2,5-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 1242-38-2 | Molecular Weight | 337.28300 | |
| Density | 1.589g/cm3 | Boiling Point | 609.1ºC at 760mmHg | |
| Molecular Formula | C18H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.6ºC | |
| Name | 2,5-dihydroxy-3-(4-nitrophenyl)-6-phenylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.589g/cm3 |
|---|---|
| Boiling Point | 609.1ºC at 760mmHg |
| Molecular Formula | C18H11NO6 |
| Molecular Weight | 337.28300 |
| Flash Point | 250.6ºC |
| Exact Mass | 337.05900 |
| PSA | 120.42000 |
| LogP | 3.50820 |
| Vapour Pressure | 1.09E-15mmHg at 25°C |
| Index of Refraction | 1.741 |
| InChIKey | OZXGEUJRKOAVLV-UHFFFAOYSA-N |
| SMILES | O=C1C(O)=C(c2ccc([N+](=O)[O-])cc2)C(=O)C(O)=C1c1ccccc1 |
|
~%
2,5-dihydroxy-3... CAS#:1242-38-2 |
| Literature: Cain,B.F. Journal of the Chemical Society, 1964 , p. 5472 - 5474 |
|
~%
2,5-dihydroxy-3... CAS#:1242-38-2 |
| Literature: Cain,B.F. Journal of the Chemical Society, 1964 , p. 5472 - 5474 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,6-Dihydroxy-5-(4-nitro-phenyl)-2-phenyl-1,4-benzochinon |
| 2,5-Dihydroxy-3-(p-nitrophenyl)-6-phenyl-p-benzoquinone |
| p-Benzoquinone,2,5-dihydroxy-3-(p-nitrophenyl)-6-phenyl |