Ethanone, 2,2,2-trifluoro-1-[4-(1-methylethyl)phenyl]- (9CI) structure
|
Common Name | Ethanone, 2,2,2-trifluoro-1-[4-(1-methylethyl)phenyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 124211-72-9 | Molecular Weight | 216.20000 | |
| Density | 1.153g/cm3 | Boiling Point | 240.4ºC at 760mmHg | |
| Molecular Formula | C11H11F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.1ºC | |
| Name | 2,2,2-trifluoro-1-(4-propan-2-ylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 240.4ºC at 760mmHg |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20000 |
| Flash Point | 115.1ºC |
| Exact Mass | 216.07600 |
| PSA | 17.07000 |
| LogP | 3.55500 |
| Vapour Pressure | 0.0381mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | JXAARZPBEHNXIL-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(C(=O)C(F)(F)F)cc1 |
|
~77%
Ethanone, 2,2,2... CAS#:124211-72-9 |
| Literature: Chemistry Letters, , # 5 p. 783 - 786 |
|
~72%
Ethanone, 2,2,2... CAS#:124211-72-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 53, # 15 p. 5667 - 5675 |
| 4'-iso-Propyl-2,2,2-trifluoroacetophenone |
| Trifluoromethyl p-isopropylphenyl ketone |
| Ethanone,2,2,2-trifluoro-1-[4-(1-methylethyl)phenyl] |
| 2,2,2-trifluoro-1-(4-isopropylphenyl)ethanone |