8-(2-phenylethyl)-3-(2-piperidin-1-ylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione structure
|
Common Name | 8-(2-phenylethyl)-3-(2-piperidin-1-ylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 124312-82-9 | Molecular Weight | 384.51500 | |
| Density | 1.21g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H32N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-(2-phenylethyl)-3-(2-piperidin-1-ylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.51500 |
| Exact Mass | 384.25300 |
| PSA | 59.38000 |
| LogP | 1.55510 |
| Index of Refraction | 1.614 |
| InChIKey | FNOIWYGSKXRSKO-UHFFFAOYSA-N |
| SMILES | O=C1NC2(CCN(CCc3ccccc3)CC2)C(=O)N1CCN1CCCCC1 |
|
~70%
8-(2-phenylethy... CAS#:124312-82-9 |
| Literature: European Journal of Medicinal Chemistry, , vol. 24, p. 185 - 188 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-(2-Phenylethyl)-3-(2-(1-piperidinyl)ethyl)-1,3,8-triazaspiro(4.5)decane-2,4-dione |
| 8-phenethyl-2-(2-piperidin-1-ylethyl)-2,4,8-triazaspiro[4.5]decane-1,3-dione |
| 1,3,8-Triazaspiro(4.5)decane-2,4-dione,8-(2-phenylethyl)-3-(2-(1-piperidinyl)ethyl) |
| (phenyl-2 ethyl)-8 [(piperidinyl-1)-2 ethyl]-3 triaza-1,3,8 spiro[4.5]decanedione-2,4 |