VU0366248 structure
|
Common Name | VU0366248 | ||
|---|---|---|---|---|
| CAS Number | 1243310-20-4 | Molecular Weight | 292.66800 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 339.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H7ClF2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.9±27.9 °C | |
Use of VU0366248VU0366248 is a mGlu5 negative allosteric modulator[1]. |
| Name | N-(3-Chloro-2-fluorophenyl)-3-cyano-5-fluorobenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | VU0366248 is a mGlu5 negative allosteric modulator[1]. |
|---|---|
| Related Catalog | |
| Target |
mGluR5 |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 339.1±42.0 °C at 760 mmHg |
| Molecular Formula | C14H7ClF2N2O |
| Molecular Weight | 292.66800 |
| Flash Point | 158.9±27.9 °C |
| Exact Mass | 292.02100 |
| PSA | 52.89000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | QDFPSPIHFOODSP-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(F)cc(C(=O)Nc2cccc(Cl)c2F)c1 |
| Benzamide, N-(3-chloro-2-fluorophenyl)-3-cyano-5-fluoro- |
| N-(3-Chloro-2-fluorophenyl)-3-cyano-5-fluorobenzamide |