2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide
Modify Date: 2026-07-24 07:06:56
2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide structure
|
Common Name | 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 1243389-75-4 | Molecular Weight | 235.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO3 |
|---|---|
| Molecular Weight | 235.28 |
| InChIKey | JZWJNJWUVNAOFJ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1ccc(O)cc1OCC1CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide? |
| A: InChIKey of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide is JZWJNJWUVNAOFJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide? |
| A: CAS number of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide is 1243389-75-4. |
| Q: What is the molecular formula of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide? |
| A: Molecular formula of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide is C13H17NO3. |
| Q: What is the Chinese name of 1243389-75-4? |
| A: Chinese name of 1243389-75-4 is 1243389-75-4. |
| Q: What is the SMILES notation of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide? |
| A: SMILES notation of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(O)cc1OCC1CC1. |
| Q: What is the English name of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide? |
| A: The English name of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide is 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide. |
| Q: What is the molecular weight of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide? |
| A: Molecular weight of 2-(Cyclopropylmethoxy)-4-hydroxy-N,N-dimethylbenzamide is 235.28. |