2,5-DI-Tert-butoxyphenol
Modify Date: 2026-07-03 17:34:56
2,5-DI-Tert-butoxyphenol structure
|
Common Name | 2,5-DI-Tert-butoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 1243391-07-2 | Molecular Weight | 238.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-DI-Tert-butoxyphenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22O3 |
|---|---|
| Molecular Weight | 238.32 |
| InChIKey | DLMKEVMZTRYHED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Oc1ccc(OC(C)(C)C)c(O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,5-DI-Tert-butoxyphenol? |
| A: InChIKey of 2,5-DI-Tert-butoxyphenol is DLMKEVMZTRYHED-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1243391-07-2? |
| A: Chinese name of 1243391-07-2 is 1243391-07-2. |
| Q: What is the SMILES notation of 2,5-DI-Tert-butoxyphenol? |
| A: SMILES notation of 2,5-DI-Tert-butoxyphenol is CC(C)(C)Oc1ccc(OC(C)(C)C)c(O)c1. |
| Q: What is the English name of 2,5-DI-Tert-butoxyphenol? |
| A: The English name of 2,5-DI-Tert-butoxyphenol is 2,5-DI-Tert-butoxyphenol. |
| Q: What is the molecular weight of 2,5-DI-Tert-butoxyphenol? |
| A: Molecular weight of 2,5-DI-Tert-butoxyphenol is 238.32. |
| Q: What is the CAS number of 2,5-DI-Tert-butoxyphenol? |
| A: CAS number of 2,5-DI-Tert-butoxyphenol is 1243391-07-2. |
| Q: What is the molecular formula of 2,5-DI-Tert-butoxyphenol? |
| A: Molecular formula of 2,5-DI-Tert-butoxyphenol is C14H22O3. |