4-(S)-1-Des(methylamine)-1-oxo-2-(R,S)-hydroxy Sertraline structure
|
Common Name | 4-(S)-1-Des(methylamine)-1-oxo-2-(R,S)-hydroxy Sertraline | ||
|---|---|---|---|---|
| CAS Number | 124345-10-4 | Molecular Weight | 307.17100 | |
| Density | 1.41g/cm3 | Boiling Point | 451.1ºC at 760 mmHg | |
| Molecular Formula | C16H12Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(S)-1-Des(methylamine)-1-oxo-2-(R,S)-hydroxy Sertraline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 451.1ºC at 760 mmHg |
| Molecular Formula | C16H12Cl2O2 |
| Molecular Weight | 307.17100 |
| Exact Mass | 306.02100 |
| PSA | 37.30000 |
| LogP | 4.07260 |
| Index of Refraction | 1.645 |
| InChIKey | KVZFTTORFMNPDL-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(c2ccc(Cl)c(Cl)c2)CC1O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-(3,4-Dichlorophenyl)-2-hydroxy-3,4-dihydro-2H-naphthalen-1-one |