2-Cyclopropoxy-N,N,5-trimethylaniline
Modify Date: 2025-09-24 17:37:15
2-Cyclopropoxy-N,N,5-trimethylaniline structure
|
Common Name | 2-Cyclopropoxy-N,N,5-trimethylaniline | ||
|---|---|---|---|---|
| CAS Number | 1243465-53-3 | Molecular Weight | 191.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Cyclopropoxy-N,N,5-trimethylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17NO |
|---|---|
| Molecular Weight | 191.27 |
| InChIKey | RBXZYVHVGPLQMH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC2CC2)c(N(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1243465-53-3? |
| A: Chinese name of 1243465-53-3 is 1243465-53-3. |
| Q: What is the CAS number of 2-Cyclopropoxy-N,N,5-trimethylaniline? |
| A: CAS number of 2-Cyclopropoxy-N,N,5-trimethylaniline is 1243465-53-3. |
| Q: What is the InChIKey of 2-Cyclopropoxy-N,N,5-trimethylaniline? |
| A: InChIKey of 2-Cyclopropoxy-N,N,5-trimethylaniline is RBXZYVHVGPLQMH-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Cyclopropoxy-N,N,5-trimethylaniline? |
| A: Molecular formula of 2-Cyclopropoxy-N,N,5-trimethylaniline is C12H17NO. |
| Q: What is the English name of 2-Cyclopropoxy-N,N,5-trimethylaniline? |
| A: The English name of 2-Cyclopropoxy-N,N,5-trimethylaniline is 2-Cyclopropoxy-N,N,5-trimethylaniline. |
| Q: What is the SMILES notation of 2-Cyclopropoxy-N,N,5-trimethylaniline? |
| A: SMILES notation of 2-Cyclopropoxy-N,N,5-trimethylaniline is Cc1ccc(OC2CC2)c(N(C)C)c1. |
| Q: What is the molecular weight of 2-Cyclopropoxy-N,N,5-trimethylaniline? |
| A: Molecular weight of 2-Cyclopropoxy-N,N,5-trimethylaniline is 191.27. |