3-(4-chlorophenyl)-8,9-dimethyl-2-phenyl-4,5-dihydro-[1]benzoxepino[5,4-c]pyrazole structure
|
Common Name | 3-(4-chlorophenyl)-8,9-dimethyl-2-phenyl-4,5-dihydro-[1]benzoxepino[5,4-c]pyrazole | ||
|---|---|---|---|---|
| CAS Number | 124405-82-9 | Molecular Weight | 400.90000 | |
| Density | 1.24g/cm3 | Boiling Point | 607.2ºC at 760mmHg | |
| Molecular Formula | C25H21ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321ºC | |
| Name | 3-(4-chlorophenyl)-8,9-dimethyl-2-phenyl-4,5-dihydro-[1]benzoxepino[5,4-c]pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 607.2ºC at 760mmHg |
| Molecular Formula | C25H21ClN2O |
| Molecular Weight | 400.90000 |
| Flash Point | 321ºC |
| Exact Mass | 400.13400 |
| PSA | 27.05000 |
| LogP | 6.41140 |
| Vapour Pressure | 4.82E-14mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | LBISNZREDGWMHC-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(cc1C)-c1nn(-c3ccccc3)c(-c3ccc(Cl)cc3)c1CCO2 |
|
~%
3-(4-chlorophen... CAS#:124405-82-9 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 28, # 1-11 p. 37 - 41 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,5-Dihydro-3-(4-chlorophenyl)-8,9-dimethyl-2-phenyl-2H-(1)benzoxepino(5,4-c)pyrazole |
| 2H-(1)Benzoxepino(5,4-c)pyrazole,4,5-dihydro-3-(4-chlorophenyl)-8,9-dimethyl-2-phenyl |