[dichloroboranyl-bis(trimethylsilyl)methyl]-trimethylsilane structure
|
Common Name | [dichloroboranyl-bis(trimethylsilyl)methyl]-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 124408-70-4 | Molecular Weight | 313.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H27BCl2Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [dichloroboranyl-bis(trimethylsilyl)methyl]-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H27BCl2Si3 |
|---|---|
| Molecular Weight | 313.29500 |
| Exact Mass | 312.08900 |
| LogP | 5.32480 |
| InChIKey | NFYAOWXDISSACM-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(B(Cl)Cl)([Si](C)(C)C)[Si](C)(C)C |
|
~86%
[dichloroborany... CAS#:124408-70-4 |
| Literature: Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), , p. 447 - 452 |
|
~%
[dichloroborany... CAS#:124408-70-4 |
| Literature: Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), , p. 447 - 452 |
| (Me3Si)3CBCl2 |
| Borane,dichloro[tris(trimethylsilyl)methyl] |
| dichloro[tris(trimethylsilyl)methyl]borane |
| tris(trimethylsilyl)boronmethyl dichloride |