2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-sulfinamide structure
|
Common Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-sulfinamide | ||
|---|---|---|---|---|
| CAS Number | 124508-99-2 | Molecular Weight | 330.32000 | |
| Density | 2.46g/cm3 | Boiling Point | 895.3ºC at 760mmHg | |
| Molecular Formula | C10H14N6O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 495.2ºC | |
| Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-sulfinamide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.46g/cm3 |
|---|---|
| Boiling Point | 895.3ºC at 760mmHg |
| Molecular Formula | C10H14N6O5S |
| Molecular Weight | 330.32000 |
| Flash Point | 495.2ºC |
| Exact Mass | 330.07500 |
| PSA | 201.84000 |
| Vapour Pressure | 1.89E-34mmHg at 25°C |
| Index of Refraction | 2.084 |
| InChIKey | NIXVOFULDIFBLB-QVRNUERCSA-N |
| SMILES | Nc1nc(S(N)=O)c2ncn(C3OC(CO)C(O)C3O)c2n1 |
|
~69%
2-amino-9-[(2R,... CAS#:124508-99-2 |
| Literature: Ramasamy, Kandasamy; Imamura, Nobutaka; Hanna, Naeem B.; Finch, Rick A.; Avery, Thomas L.; et al. Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1220 - 1225 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Sulfinosine |
| 3-deazasulfinosine |