5-(2-Bromo-5-fluorophenyl)-1-tert-butyl-4-iodo-1H-pyrazole structure
|
Common Name | 5-(2-Bromo-5-fluorophenyl)-1-tert-butyl-4-iodo-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 1245643-25-7 | Molecular Weight | 423.063 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 403.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H13BrFIN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.0±28.7 °C | |
| Name | 5-(2-bromo-5-fluorophenyl)-1-tert-butyl-4-iodopyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 403.9±45.0 °C at 760 mmHg |
| Molecular Formula | C13H13BrFIN2 |
| Molecular Weight | 423.063 |
| Flash Point | 198.0±28.7 °C |
| Exact Mass | 421.929077 |
| PSA | 17.82000 |
| LogP | 5.09 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | WGWGNEHGEINCNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)n1ncc(I)c1-c1cc(F)ccc1Br |
| HS Code | 2933199090 |
|---|
|
~84%
5-(2-Bromo-5-fl... CAS#:1245643-25-7 |
| Literature: WO2010/111418 A2, ; Page/Page column 100-101 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrazole, 5-(2-bromo-5-fluorophenyl)-1-(1,1-dimethylethyl)-4-iodo- |
| 5-(2-Bromo-5-fluorophenyl)-1-(tert-butyl)-4-iodo-1H-pyrazole |
| 5-(2-Bromo-5-fluorophenyl)-4-iodo-1-(2-methyl-2-propanyl)-1H-pyrazole |