2?-METHOXY-N-METHYL-4,4?-BIPYRIDIN-2-AMINE structure
|
Common Name | 2?-METHOXY-N-METHYL-4,4?-BIPYRIDIN-2-AMINE | ||
|---|---|---|---|---|
| CAS Number | 1245646-00-7 | Molecular Weight | 215.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-methoxypyridin-4-yl)-N-methylpyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13N3O |
|---|---|
| Molecular Weight | 215.25100 |
| Exact Mass | 215.10600 |
| PSA | 50.27000 |
| LogP | 1.61580 |
| InChIKey | SFRYBDGYFFCCCM-UHFFFAOYSA-N |
| SMILES | CNc1cc(-c2ccnc(OC)c2)ccn1 |
| HS Code | 2933399090 |
|---|
|
~%
2?-METHOXY-N-ME... CAS#:1245646-00-7 |
| Literature: European Journal of Organic Chemistry, , # 3 p. 595 - 603 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2'-methoxy-N-methyl-4,4'-bipyridin-2-amine |