methyl 3-(7-chloro-1-oxoisoindolin-2-yl)benzoate structure
|
Common Name | methyl 3-(7-chloro-1-oxoisoindolin-2-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 1245646-74-5 | Molecular Weight | 301.72400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-(4-chloro-3-oxo-1H-isoindol-2-yl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12ClNO3 |
|---|---|
| Molecular Weight | 301.72400 |
| Exact Mass | 301.05100 |
| PSA | 46.61000 |
| LogP | 3.35200 |
| InChIKey | GRTJZIYUVGAQLO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(N2Cc3cccc(Cl)c3C2=O)c1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyl 3-(7-chloro-1-oxoisoindolin-2-yl)benzoate |