1-Cbz-3-ethylpiperidine-3-carboxylic Acid structure
|
Common Name | 1-Cbz-3-ethylpiperidine-3-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 1245808-57-4 | Molecular Weight | 291.342 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 451.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8±28.7 °C | |
| Name | 1-[(Benzyloxy)carbonyl]-3-ethyl-3-piperidinecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.5±45.0 °C at 760 mmHg |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.342 |
| Flash Point | 226.8±28.7 °C |
| Exact Mass | 291.147064 |
| PSA | 66.84000 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | UMJDUZFRWNBBGO-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)O)CCCN(C(=O)OCc2ccccc2)C1 |
| HS Code | 2933399090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Piperidinedicarboxylic acid, 3-ethyl-, 1-(phenylmethyl) ester |
| 1-[(Benzyloxy)carbonyl]-3-ethyl-3-piperidinecarboxylic acid |