benzyl cis-(6-hydroxymethyl)cyclohex-3-enylcarbamate
Modify Date: 2025-09-29 19:34:57
benzyl cis-(6-hydroxymethyl)cyclohex-3-enylcarbamate structure
|
Common Name | benzyl cis-(6-hydroxymethyl)cyclohex-3-enylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 124678-01-9 | Molecular Weight | 275.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl cis-(6-hydroxymethyl)cyclohex-3-enylcarbamate |
|---|
| Molecular Formula | C16H21NO3 |
|---|---|
| Molecular Weight | 275.34300 |
| Exact Mass | 275.15200 |
| PSA | 49.77000 |
| LogP | 2.58210 |
| Index of Refraction | 1.573 |
| InChIKey | AOAJLOBEFOQPKW-GJZGRUSLSA-N |
| SMILES | CN(C(=O)OCc1ccccc1)C1CC=CCC1CO |
| HS Code | 2924299090 |
|---|
|
~%
benzyl cis-(6-h... CAS#:124678-01-9 |
| Literature: Peter, Maria; Van Der Eycken, Johan; Bernath, Gabor; Fueloep, Ferenc Tetrahedron Asymmetry, 1998 , vol. 9, # 13 p. 2339 - 2347 |
|
~%
benzyl cis-(6-h... CAS#:124678-01-9 |
| Literature: Rotella, David P. Tetrahedron Letters, 1989 , vol. 30, # 15 p. 1913 - 1916 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |