Mono-POC Methyl Tenofovir (Mixture of DiastereoMers) structure
|
Common Name | Mono-POC Methyl Tenofovir (Mixture of DiastereoMers) | ||
|---|---|---|---|---|
| CAS Number | 1246812-16-7 | Molecular Weight | 417.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24N5O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-methoxyphosphoryl]oxymethyl propan-2-yl carbonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24N5O7P |
|---|---|
| Molecular Weight | 417.35400 |
| Exact Mass | 417.14100 |
| PSA | 159.72000 |
| LogP | 2.72750 |
| InChIKey | PPZMGSJRJBOSTD-XQSUJFPPSA-N |
| SMILES | COP(=O)(COC(C)Cn1cnc2c(N)ncnc21)OCOC(=O)OC(C)C |
| (8R)-9-(6-Amino-9H-purin-9-yl)-5-methoxy-8-methyl-2,4,7-trioxa-5-phosphanonanoic Acid Methyl 1-Methylethyl Ester 5-Oxide |
| Tenofovir Methyl Monoisoproxil |
| Mono-POC Methyl Tenofovir (Mixture of Diastereomers) |