Eperisone-d10 hydrochloride structure
|
Common Name | Eperisone-d10 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1246819-46-4 | Molecular Weight | 305.91 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16D10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Eperisone-d10 hydrochlorideEperisone-d10 ((±)-Eperisone-d10) hydrochloride is the deuterium labeled Eperisone hydrochloride. Eperisone Hydrochloride ((±)-Eperisone hydrochloride) is an antispastic agent used for treatment of diseases characterized by muscle stiffness and pain. It works by relaxing both skeletal muscles and vascularsmooth muscles, thus demonstrating avariety of effects such as reduction ofmyotonia, improvement of circulationand suppression of the pain reflex. Eperisone Hydrochloride ((±)-Eperisone hydrochloride) is a centrally acting muscle relaxant inhibiting the pain reflex pathway, having a vasodilator effect[1][2 [3]. |
| Name | Eperisone-d10 hydrochloride |
|---|
| Description | Eperisone-d10 ((±)-Eperisone-d10) hydrochloride is the deuterium labeled Eperisone hydrochloride. Eperisone Hydrochloride ((±)-Eperisone hydrochloride) is an antispastic agent used for treatment of diseases characterized by muscle stiffness and pain. It works by relaxing both skeletal muscles and vascularsmooth muscles, thus demonstrating avariety of effects such as reduction ofmyotonia, improvement of circulationand suppression of the pain reflex. Eperisone Hydrochloride ((±)-Eperisone hydrochloride) is a centrally acting muscle relaxant inhibiting the pain reflex pathway, having a vasodilator effect[1][2 [3]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C17H16D10ClNO |
|---|---|
| Molecular Weight | 305.91 |
| InChIKey | GTAXGNCCEYZRII-WGXYFZCDSA-N |
| SMILES | CCc1ccc(C(=O)C(C)CN2CCCCC2)cc1.Cl |