[(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine
Modify Date: 2026-06-28 20:04:05
amine Structure](https://www.chemsrc.com/extcaspic/430/1246824-22-5.png)
[(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine structure
|
Common Name | [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine | ||
|---|---|---|---|---|
| CAS Number | 1246824-22-5 | Molecular Weight | 376.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H26BrNO2S |
|---|---|
| Molecular Weight | 376.4 |
| InChIKey | YXFWYXZRQHNOBX-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(C)(C)CC(C)(C)C)cc1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine? |
| A: InChIKey of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine is YXFWYXZRQHNOBX-UHFFFAOYSA-N. |
| Q: What is the CAS number of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine? |
| A: CAS number of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine is 1246824-22-5. |
| Q: What is the molecular formula of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine? |
| A: Molecular formula of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine is C16H26BrNO2S. |
| Q: What is the molecular weight of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine? |
| A: Molecular weight of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine is 376.4. |
| Q: What is the SMILES notation of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine? |
| A: SMILES notation of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine is Cc1cc(C)c(S(=O)(=O)NC(C)(C)CC(C)(C)C)cc1Br. |
| Q: What is the Chinese name of 1246824-22-5? |
| A: Chinese name of 1246824-22-5 is 1246824-22-5. |
| Q: What is the English name of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine? |
| A: The English name of [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine is [(5-Bromo-2,4-dimethylphenyl)sulfonyl](1,1,3,3-tetramethylbutyl)amine. |