2-BUTYL-4-CHLORO-5-(HYDROXYMETHYL)-1-{[2'-[(TRIPHENYLMETHYL)TETRAZOLE-5YL]BIPHENYL-4-YL]METHYL}IMIDAZOLE structure
|
Common Name | 2-BUTYL-4-CHLORO-5-(HYDROXYMETHYL)-1-{[2'-[(TRIPHENYLMETHYL)TETRAZOLE-5YL]BIPHENYL-4-YL]METHYL}IMIDAZOLE | ||
|---|---|---|---|---|
| CAS Number | 124751-00-4 | Molecular Weight | 665.22500 | |
| Density | 1.225g/cm3 | Boiling Point | 856.623ºC at 760 mmHg | |
| Molecular Formula | C41H37ClN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 471.868ºC | |
| Name | [2-butyl-5-chloro-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 856.623ºC at 760 mmHg |
| Molecular Formula | C41H37ClN6O |
| Molecular Weight | 665.22500 |
| Flash Point | 471.868ºC |
| Exact Mass | 664.27200 |
| PSA | 81.65000 |
| LogP | 8.58040 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | ZKJNVODQIYQUNQ-UHFFFAOYSA-N |
| SMILES | CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
|
~%
2-BUTYL-4-CHLOR... CAS#:124751-00-4 |
| Literature: US2004/97568 A1, ; Page/Page column 5 ; |
|
~46%
2-BUTYL-4-CHLOR... CAS#:124751-00-4 |
| Literature: US5128355 A1, ; US 5128355 A |
|
~%
2-BUTYL-4-CHLOR... CAS#:124751-00-4 |
| Literature: WO2004/66997 A2, ; Page/Page column 46-47 ; |
|
~%
2-BUTYL-4-CHLOR... CAS#:124751-00-4 |
| Literature: US5298517 A1, ; US 5298517 A |
|
~95%
2-BUTYL-4-CHLOR... CAS#:124751-00-4 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 54, # 12 p. 754 - 757 |
|
~33%
2-BUTYL-4-CHLOR... CAS#:124751-00-4 |
| Literature: EP1833801 B1, ; Page/Page column 14 ; |
|
~%
2-BUTYL-4-CHLOR... CAS#:124751-00-4 |
| Literature: WO2006/38223 A1, ; Page/Page column 6-7 ; |
|
~%
2-BUTYL-4-CHLOR... CAS#:124751-00-4 |
| Literature: EP1833801 B1, ; Page/Page column 14 ; |
|
~68%
2-BUTYL-4-CHLOR... CAS#:124751-00-4 |
| Literature: WO2006/81807 A2, ; Page/Page column 16; 18; 20; 28-29 ; |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| N-Trityl Losartan |
| Trityllosartan |