2-Amino-5-methyl-3-nitro-benzoic acid methyl ester structure
|
Common Name | 2-Amino-5-methyl-3-nitro-benzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1248541-72-1 | Molecular Weight | 210.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 2-amino-5-methyl-3-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10N2O4 |
|---|---|
| Molecular Weight | 210.18700 |
| Exact Mass | 210.06400 |
| PSA | 98.14000 |
| LogP | 2.37640 |
| InChIKey | BMVWWCPPMDIQTE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C)cc([N+](=O)[O-])c1N |
| HS Code | 2922499990 |
|---|
|
~80%
2-Amino-5-methy... CAS#:1248541-72-1 |
| Literature: MERCK SERONO S.A.; THUNUGUNTLA, Siva Sanjeeva Rao; SUBRAMANYA, Hosahalli; KUNNAM, Satish Reddy; SANIVARU VIJAY, Sekhar Reddy; BINGI, Chakrapani; KUSANUR, Raviraj; SCHWARZ, Matthias; ARLT, Michael Patent: WO2010/115736 A2, 2010 ; Location in patent: Page/Page column 78-79 ; WO 2010/115736 A2 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-amino-5-methyl-3-nitro-benzoic acid methyl ester |