4-Acetamido-3,4-dimethylpentanoic acid
Modify Date: 2026-07-20 11:24:37
4-Acetamido-3,4-dimethylpentanoic acid structure
|
Common Name | 4-Acetamido-3,4-dimethylpentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1248549-84-9 | Molecular Weight | 187.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Acetamido-3,4-dimethylpentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H17NO3 |
|---|---|
| Molecular Weight | 187.24 |
| InChIKey | GLUSUHGFWDWWMG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)(C)C(C)CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1248549-84-9? |
| A: Chinese name of 1248549-84-9 is 1248549-84-9. |
| Q: What is the CAS number of 4-Acetamido-3,4-dimethylpentanoic acid? |
| A: CAS number of 4-Acetamido-3,4-dimethylpentanoic acid is 1248549-84-9. |
| Q: What is the English name of 4-Acetamido-3,4-dimethylpentanoic acid? |
| A: The English name of 4-Acetamido-3,4-dimethylpentanoic acid is 4-Acetamido-3,4-dimethylpentanoic acid. |
| Q: What is the SMILES notation of 4-Acetamido-3,4-dimethylpentanoic acid? |
| A: SMILES notation of 4-Acetamido-3,4-dimethylpentanoic acid is CC(=O)NC(C)(C)C(C)CC(=O)O. |
| Q: What is the molecular weight of 4-Acetamido-3,4-dimethylpentanoic acid? |
| A: Molecular weight of 4-Acetamido-3,4-dimethylpentanoic acid is 187.24. |
| Q: What is the molecular formula of 4-Acetamido-3,4-dimethylpentanoic acid? |
| A: Molecular formula of 4-Acetamido-3,4-dimethylpentanoic acid is C9H17NO3. |
| Q: What is the InChIKey of 4-Acetamido-3,4-dimethylpentanoic acid? |
| A: InChIKey of 4-Acetamido-3,4-dimethylpentanoic acid is GLUSUHGFWDWWMG-UHFFFAOYSA-N. |