(2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine
Modify Date: 2026-07-30 15:35:19
(2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine structure
|
Common Name | (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 1248813-62-8 | Molecular Weight | 218.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14N2S |
|---|---|
| Molecular Weight | 218.32 |
| InChIKey | FVZKBZDCFOXFJS-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2nc(CN)cs2)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1248813-62-8? |
| A: Chinese name of 1248813-62-8 is 1248813-62-8. |
| Q: What is the SMILES notation of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine? |
| A: SMILES notation of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine is Cc1cccc(-c2nc(CN)cs2)c1C. |
| Q: What is the molecular weight of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine? |
| A: Molecular weight of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine is 218.32. |
| Q: What is the InChIKey of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine? |
| A: InChIKey of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine is FVZKBZDCFOXFJS-UHFFFAOYSA-N. |
| Q: What is the CAS number of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine? |
| A: CAS number of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine is 1248813-62-8. |
| Q: What is the molecular formula of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine? |
| A: Molecular formula of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine is C12H14N2S. |
| Q: What is the English name of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine? |
| A: The English name of (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine is (2-(2,3-Dimethylphenyl)thiazol-4-yl)methanamine. |