2-(5-Chloro-2H-Benzotriazol-2-Yl)-6-(2-Methyl-2-Propanyl)-4-Vinylphenol structure
|
Common Name | 2-(5-Chloro-2H-Benzotriazol-2-Yl)-6-(2-Methyl-2-Propanyl)-4-Vinylphenol | ||
|---|---|---|---|---|
| CAS Number | 124883-10-9 | Molecular Weight | 327.80800 | |
| Density | 1.235g/cm3 | Boiling Point | 479.558ºC at 760 mmHg | |
| Molecular Formula | C18H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.828ºC | |
| Name | 2-tert-butyl-6-(5-chlorobenzotriazol-2-yl)-4-ethenylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 479.558ºC at 760 mmHg |
| Molecular Formula | C18H18ClN3O |
| Molecular Weight | 327.80800 |
| Flash Point | 243.828ºC |
| Exact Mass | 327.11400 |
| PSA | 50.94000 |
| LogP | 4.72000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | UNWOQCDCGCSPSN-UHFFFAOYSA-N |
| SMILES | C=Cc1cc(-n2nc3ccc(Cl)cc3n2)c(O)c(C(C)(C)C)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(5-Chloro-2H-Benzotriazol-2-Yl)-6-(2-Methyl-2-Propanyl)-4-Vinylphenol |