2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid
Modify Date: 2025-08-25 18:45:38
2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid structure
|
Common Name | 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 1248961-95-6 | Molecular Weight | 194.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6N2O4 |
|---|---|
| Molecular Weight | 194.14 |
| InChIKey | JKSACRIQYVMHTQ-UHFFFAOYSA-N |
| SMILES | Cc1oc(-c2ccon2)nc1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1248961-95-6? |
| A: Chinese name of 1248961-95-6 is 1248961-95-6. |
| Q: What is the CAS number of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid? |
| A: CAS number of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid is 1248961-95-6. |
| Q: What is the molecular weight of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid? |
| A: Molecular weight of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid is 194.14. |
| Q: What is the SMILES notation of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid? |
| A: SMILES notation of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid is Cc1oc(-c2ccon2)nc1C(=O)O. |
| Q: What is the English name of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid? |
| A: The English name of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid is 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid. |
| Q: What is the molecular formula of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid? |
| A: Molecular formula of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid is C8H6N2O4. |
| Q: What is the InChIKey of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid? |
| A: InChIKey of 2-(3-Isoxazolyl)-5-methyloxazole-4-carboxylic Acid is JKSACRIQYVMHTQ-UHFFFAOYSA-N. |