2-ethanethioylsulfanylethyl(trimethyl)azanium,iodide structure
|
Common Name | 2-ethanethioylsulfanylethyl(trimethyl)azanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 124901-07-1 | Molecular Weight | 305.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H16INS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethanethioylsulfanylethyl(trimethyl)azanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H16INS2 |
|---|---|
| Molecular Weight | 305.24300 |
| Exact Mass | 304.97700 |
| PSA | 57.39000 |
| InChIKey | XXZDUZNAFMFVGI-UHFFFAOYSA-M |
| SMILES | CC(=S)SCC[N+](C)(C)C.[I-] |
|
~%
2-ethanethioyls... CAS#:124901-07-1 |
| Literature: Bost; Shealy Journal of the American Chemical Society, 1951 , vol. 73, p. 25,26 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Trimethyl-(2-thioacetylmercapto-aethyl)-ammonium,Jodid |
| trimethyl-(2-thioacetylsulfanyl-ethyl)-ammonium,iodide |
| Ethanaminium,N,N,N-trimethyl-2-[(1-thioxoethyl)thio]-,iodide |