4-(4-tert-butylphenoxy)benzene-1,2-dicarbonitrile structure
|
Common Name | 4-(4-tert-butylphenoxy)benzene-1,2-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 125023-51-0 | Molecular Weight | 276.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-tert-butylphenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H16N2O |
|---|---|
| Molecular Weight | 276.33200 |
| Exact Mass | 276.12600 |
| PSA | 56.81000 |
| LogP | 4.51976 |
| InChIKey | JWUUXSUVPLUBCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(C#N)c(C#N)c2)cc1 |
|
~89%
4-(4-tert-butyl... CAS#:125023-51-0 |
| Literature: Takagi, Yasufumi; Ohta, Kazuchika; Shimosugi, Shota; Fujii, Tatsuya; Itoh, Eiji Journal of Materials Chemistry, 2012 , vol. 22, # 29 p. 14418 - 14425 |
|
~%
4-(4-tert-butyl... CAS#:125023-51-0 |
| Literature: Young, Joseph G.; Onyebuagu, William Journal of Organic Chemistry, 1990 , vol. 55, # 7 p. 2155 - 2159 |
| 4-(p-tert-butylphenoxy)phthalonitrile |
| 1,2-Benzenedicarbonitrile,4-[4-(1,1-dimethylethyl)phenoxy] |
| 4-tert-butylphenoxyphthalonitrile |
| 4-[4-(tert-butyl)phenoxy]-1,2-dicyanobenzene |
| 4-(4-t-butylphenoxy)phthalonitrile |
| 4-(4-tert-butyl-phenoxy)-phthalonitrile |