6-(4-acetylphenyl)sulfanyl-1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione structure
|
Common Name | 6-(4-acetylphenyl)sulfanyl-1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 125056-70-4 | Molecular Weight | 350.39000 | |
| Density | 1.39g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-acetylphenyl)sulfanyl-1-(2-hydroxyethoxymethyl)-5-methylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.39000 |
| Exact Mass | 350.09400 |
| PSA | 126.95000 |
| LogP | 1.57750 |
| Index of Refraction | 1.634 |
| InChIKey | ZSERKDZVJSLUNP-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Sc2c(C)c(=O)[nH]c(=O)n2COCCO)cc1 |
|
~%
6-(4-acetylphen... CAS#:125056-70-4 |
| Literature: Tanaka, Hiromichi; Takashima, Hideaki; Ubasawa, Masaru; Sekiya, Kouichi; Nitta, Iasei; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 2 p. 337 - 345 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4(1H,3H)-Pyrimidinedione,6-[(4-acetylphenyl)thio]-1-[(2-hydroxyethoxy)methyl]-5-methyl |
| 1-((2-Hydroxyethoxy)methyl)-6-((4-(methylcarbonyl)phenyl)thio)thymine |
| 4'-AcHEPT |