6-Amino-1-methyl-5-(propylamino)uracil structure
|
Common Name | 6-Amino-1-methyl-5-(propylamino)uracil | ||
|---|---|---|---|---|
| CAS Number | 125092-42-4 | Molecular Weight | 198.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N4O2 | Melting Point | 220 °C(dec.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-amino-1-methyl-5-(propylamino)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 220 °C(dec.) |
|---|---|
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.22200 |
| Exact Mass | 198.11200 |
| PSA | 93.17000 |
| LogP | 0.54420 |
| Index of Refraction | 1.577 |
| InChIKey | PXXPWRGFQVGQAZ-UHFFFAOYSA-N |
| SMILES | CCCNc1c(N)n(C)c(=O)[nH]c1=O |
|
~%
6-Amino-1-methy... CAS#:125092-42-4 |
| Literature: Rybar, Alfonz; Hesek, Dusan; Szemes, Fridrich; Alfoeldi, Juraj; Tegza, Marian Collection of Czechoslovak Chemical Communications, 1990 , vol. 55, # 9 p. 2257 - 2269 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4(1H,3H)-Pyrimidinedione,6-amino-1-methyl-5-(propylamino) |
| 1-Methyl-5-propylamino-6-aminouracil |