acetic acid,[4-(10-hydroxy-3-methylanthracen-9-yl)phenyl] acetate
Modify Date: 2025-09-21 11:11:36
![acetic acid,[4-(10-hydroxy-3-methylanthracen-9-yl)phenyl] acetate Structure](https://image.chemsrc.com/caspic/009/1251-78-1.png)
acetic acid,[4-(10-hydroxy-3-methylanthracen-9-yl)phenyl] acetate structure
|
Common Name | acetic acid,[4-(10-hydroxy-3-methylanthracen-9-yl)phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 1251-78-1 | Molecular Weight | 402.43900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,[4-(10-hydroxy-3-methylanthracen-9-yl)phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H22O5 |
|---|---|
| Molecular Weight | 402.43900 |
| Exact Mass | 402.14700 |
| PSA | 83.83000 |
| LogP | 5.69020 |
| InChIKey | YCUCFDQLYAZFPN-UHFFFAOYSA-N |
| SMILES | CC(=O)O.CC(=O)Oc1ccc(-c2c3ccccc3c(O)c3cc(C)ccc23)cc1 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 9-Anthracenol,10-[4-(acetyloxy)phenyl]-2-methyl-,acetate |
| 10-(4'-acetoxyphenyl)-2-methyl-9-acetoxyanthracene |
| 9-Acetoxy-2-methyl-10<4-acetoxy-phenyl>-anthracen |