1,1,2,2,3,3,4,4-octafluoro-5-iodo-5-(trifluoromethyl)cyclopentane structure
|
Common Name | 1,1,2,2,3,3,4,4-octafluoro-5-iodo-5-(trifluoromethyl)cyclopentane | ||
|---|---|---|---|---|
| CAS Number | 125112-67-6 | Molecular Weight | 407.95100 | |
| Density | 2.15g/cm3 | Boiling Point | 124.5ºC at 760 mmHg | |
| Molecular Formula | C6F11I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 46.2ºC | |
| Name | 1,1,2,2,3,3,4,4-octafluoro-5-iodo-5-(trifluoromethyl)cyclopentane |
|---|---|
| Synonym | More Synonyms |
| Density | 2.15g/cm3 |
|---|---|
| Boiling Point | 124.5ºC at 760 mmHg |
| Molecular Formula | C6F11I |
| Molecular Weight | 407.95100 |
| Flash Point | 46.2ºC |
| Exact Mass | 407.88700 |
| LogP | 4.27730 |
| Vapour Pressure | 15.4mmHg at 25°C |
| Index of Refraction | 1.363 |
| InChIKey | WKHPXJGCMGZHKR-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C1(I)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| HS Code | 2903890090 |
|---|
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Perfluoro-1-methylcyclopentyl iodide |
| 1-iodoperfluoromethylcyclopentane |
| PERFLUORO-1-IODO-1-METHYLCYCLOPENTANE |
| 1-iodo-1-trifluoromethylperfluorocyclopentane |