N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide
Modify Date: 2025-08-29 21:32:25
![N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide Structure](https://www.chemsrc.com/extcaspic/441/1251648-22-2.png)
N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide structure
|
Common Name | N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide | ||
|---|---|---|---|---|
| CAS Number | 1251648-22-2 | Molecular Weight | 462.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19ClN2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H19ClN2O6S |
|---|---|
| Molecular Weight | 462.9 |
| InChIKey | MFXCCBADNULLHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N2C=C(C(=O)N3CCOCC3)S(=O)(=O)c3ccc(Cl)cc32)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide? |
| A: SMILES notation of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide is COC(=O)c1ccc(N2C=C(C(=O)N3CCOCC3)S(=O)(=O)c3ccc(Cl)cc32)cc1. |
| Q: What is the InChIKey of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide? |
| A: InChIKey of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide is MFXCCBADNULLHQ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1251648-22-2? |
| A: Chinese name of 1251648-22-2 is 1251648-22-2. |
| Q: What is the CAS number of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide? |
| A: CAS number of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide is 1251648-22-2. |
| Q: What is the molecular formula of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide? |
| A: Molecular formula of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide is C21H19ClN2O6S. |
| Q: What is the molecular weight of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide? |
| A: Molecular weight of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide is 462.9. |
| Q: What is the English name of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide? |
| A: The English name of N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide is N-{3-methoxy-2-[(methylamino)carbonyl]-1-benzothien-5-yl}-2-furamide. |