3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester
Modify Date: 2026-08-24 23:15:51
3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester structure
|
Common Name | 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester | ||
|---|---|---|---|---|
| CAS Number | 1251908-75-4 | Molecular Weight | 319.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H21NO8 |
|---|---|
| Molecular Weight | 319.31 |
| InChIKey | GZMGHDVOWSDCPZ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCC(=O)ON1C(=O)CCC1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester? |
| A: SMILES notation of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester is COCCOCCOCCOCC(=O)ON1C(=O)CCC1=O. |
| Q: What is the molecular formula of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester? |
| A: Molecular formula of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester is C13H21NO8. |
| Q: What is the CAS number of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester? |
| A: CAS number of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester is 1251908-75-4. |
| Q: What is the InChIKey of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester? |
| A: InChIKey of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester is GZMGHDVOWSDCPZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1251908-75-4? |
| A: Chinese name of 1251908-75-4 is 1251908-75-4. |
| Q: What is the molecular weight of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester? |
| A: Molecular weight of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester is 319.31. |
| Q: What is the English name of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester? |
| A: The English name of 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester is 3,6,9,12-Tetraoxatridecanoic acid, 2,5-dioxo-1-pyrrolidinyl ester. |