2,5-Diphenylthiophene-3,4-diamine
Modify Date: 2025-09-09 20:37:10
2,5-Diphenylthiophene-3,4-diamine structure
|
Common Name | 2,5-Diphenylthiophene-3,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 1252760-27-2 | Molecular Weight | 266.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-Diphenylthiophene-3,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14N2S |
|---|---|
| Molecular Weight | 266.4 |
| InChIKey | HZDXSLSFRHXJQU-UHFFFAOYSA-N |
| SMILES | Nc1c(-c2ccccc2)sc(-c2ccccc2)c1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,5-Diphenylthiophene-3,4-diamine? |
| A: Molecular weight of 2,5-Diphenylthiophene-3,4-diamine is 266.4. |
| Q: What is the InChIKey of 2,5-Diphenylthiophene-3,4-diamine? |
| A: InChIKey of 2,5-Diphenylthiophene-3,4-diamine is HZDXSLSFRHXJQU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,5-Diphenylthiophene-3,4-diamine? |
| A: CAS number of 2,5-Diphenylthiophene-3,4-diamine is 1252760-27-2. |
| Q: What is the SMILES notation of 2,5-Diphenylthiophene-3,4-diamine? |
| A: SMILES notation of 2,5-Diphenylthiophene-3,4-diamine is Nc1c(-c2ccccc2)sc(-c2ccccc2)c1N. |
| Q: What is the English name of 2,5-Diphenylthiophene-3,4-diamine? |
| A: The English name of 2,5-Diphenylthiophene-3,4-diamine is 2,5-Diphenylthiophene-3,4-diamine. |
| Q: What is the molecular formula of 2,5-Diphenylthiophene-3,4-diamine? |
| A: Molecular formula of 2,5-Diphenylthiophene-3,4-diamine is C16H14N2S. |
| Q: What is the Chinese name of 1252760-27-2? |
| A: Chinese name of 1252760-27-2 is 1252760-27-2. |