boc-lys(z)(isopropyl)-oh structure
|
Common Name | boc-lys(z)(isopropyl)-oh | ||
|---|---|---|---|---|
| CAS Number | 125323-99-1 | Molecular Weight | 603.83300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H57N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | boc-lys(z)(isopropyl)-oh |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H57N3O6 |
|---|---|
| Molecular Weight | 603.83300 |
| Exact Mass | 603.42500 |
| PSA | 117.20000 |
| LogP | 8.20500 |
| InChIKey | SCMKUYJJYHUAJP-SFHVURJKSA-N |
| SMILES | CC(C)N(CCCCC(NC(=O)OC(C)(C)C)C(=O)O)C(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
boc-lys(z)(isop... CAS#:125323-99-1 |
| Literature: Acosta, C. Kirk; Bahr, Martin L.; Burdett, James E.; Cessac, James W.; Martinez, Rudy A.; et al. Journal of Chemical Research, Miniprint, 1991 , # 5 p. 914 - 934 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-Met-Leu-Phe |
| tert-butyloxycarbonyl-methionyl-leucyl-phenylalanine |
| Boc-Met-Leu-Pje-OH |
| t-Boc-Met-Leu-Phe-OH |
| N-T-BOC-MET-LEU-PHE |
| Boc-L-Met-L-Leu-L-Phe-OH |
| Boc-MLF,Boc-1 |
| t-butyloxycarbonyl-methionyl-leucyl-phenylalanine |
| tert-butoxycarbonyl-Met-Leu-Phe peptide |