5-bromo-4-chloro-3-indoxyl-beta-l-fucopyranoside structure
|
Common Name | 5-bromo-4-chloro-3-indoxyl-beta-l-fucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 125328-84-9 | Molecular Weight | 392.63000 | |
| Density | 1.796g/cm3 | Boiling Point | 611.1ºC at 760 mmHg | |
| Molecular Formula | C14H15BrClNO5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 323.4ºC | |
| Name | (2R,3S,4R,5S,6S)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-methyloxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.796g/cm3 |
|---|---|
| Boiling Point | 611.1ºC at 760 mmHg |
| Molecular Formula | C14H15BrClNO5 |
| Molecular Weight | 392.63000 |
| Flash Point | 323.4ºC |
| Exact Mass | 390.98200 |
| PSA | 94.94000 |
| LogP | 1.79010 |
| Vapour Pressure | 8.63E-16mmHg at 25°C |
| Index of Refraction | 1.709 |
| InChIKey | ZMYJTGDNFZJYFN-FAKBCLHFSA-N |
| SMILES | CC1OC(Oc2c[nH]c3ccc(Br)c(Cl)c23)C(O)C(O)C1O |
| Storage condition | −20°C |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| HS Code | 29400090 |
| W0443 |
| 5-Bromo-4-chloro-3-indolyl |A-L-fucopyranoside |