(2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide
Modify Date: 2026-08-19 11:41:32
(2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide structure
|
Common Name | (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide | ||
|---|---|---|---|---|
| CAS Number | 1253641-78-9 | Molecular Weight | 180.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H12N4O |
|---|---|
| Molecular Weight | 180.21 |
| InChIKey | LTAWUFZEYPSJBK-MQQKCMAXSA-N |
| SMILES | CC=CC=CC(=O)NCCN=[N+]=[N-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide? |
| A: InChIKey of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide is LTAWUFZEYPSJBK-MQQKCMAXSA-N. |
| Q: What is the CAS number of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide? |
| A: CAS number of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide is 1253641-78-9. |
| Q: What is the Chinese name of 1253641-78-9? |
| A: Chinese name of 1253641-78-9 is 1253641-78-9. |
| Q: What is the SMILES notation of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide? |
| A: SMILES notation of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide is CC=CC=CC(=O)NCCN=[N+]=[N-]. |
| Q: What is the English name of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide? |
| A: The English name of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide is (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide. |
| Q: What is the molecular formula of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide? |
| A: Molecular formula of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide is C8H12N4O. |
| Q: What is the molecular weight of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide? |
| A: Molecular weight of (2E,4E)-N-(2-Azidoethyl)-2,4-hexadienamide is 180.21. |