5-(2-naphthalenylsulfonyl)-2,4-thiazolidinedione structure
|
Common Name | 5-(2-naphthalenylsulfonyl)-2,4-thiazolidinedione | ||
|---|---|---|---|---|
| CAS Number | 125518-46-9 | Molecular Weight | 307.34500 | |
| Density | 1.547g/cm3 | Boiling Point | 642.5ºC at 760mmHg | |
| Molecular Formula | C13H9NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.4ºC | |
| Name | 5-naphthalen-2-ylsulfonyl-1,3-thiazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.547g/cm3 |
|---|---|
| Boiling Point | 642.5ºC at 760mmHg |
| Molecular Formula | C13H9NO4S2 |
| Molecular Weight | 307.34500 |
| Flash Point | 342.4ºC |
| Exact Mass | 306.99700 |
| PSA | 117.48000 |
| LogP | 3.27930 |
| Vapour Pressure | 2.12E-16mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | ITLAZBMGSXRIEF-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(S(=O)(=O)c2ccc3ccccc3c2)S1 |
|
~46%
5-(2-naphthalen... CAS#:125518-46-9 |
| Literature: Zask; Jirkovsky; Nowicki; McCaleb Journal of Medicinal Chemistry, 1990 , vol. 33, # 5 p. 1418 - 1423 |
|
~%
5-(2-naphthalen... CAS#:125518-46-9 |
| Literature: Wrobel, Jay; Li, Zenan; Dietrich, Arlene; McCaleb, Michael; Mihan, Brenda; Sredy, Janet; Sullivan, Donald Journal of Medicinal Chemistry, 1998 , vol. 41, # 7 p. 1084 - 1091 |
| 5-(Naphthalene-2-sulfonyl)-thiazolidine-2,4-dione |
| 5-(2-Naphthylsulfonyl)-2,4-thiazolidinedione |
| 5-(2-naphthylsulfonyl)-thiazolidine-2,4-dione |
| 2,4-Thiazolidinedione,5-(2-naphthalenylsulfonyl) |
| Y-31,637 |
| 5-(2-Naphthalenylsulfonyl)-2,4-thiazolidinedione |