Methyl 2,4,6-trifluoro-3-nitrobenzoate
Modify Date: 2026-07-06 19:32:04
Methyl 2,4,6-trifluoro-3-nitrobenzoate structure
|
Common Name | Methyl 2,4,6-trifluoro-3-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 125568-72-1 | Molecular Weight | 235.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2,4,6-trifluoro-3-nitrobenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H4F3NO4 |
|---|---|
| Molecular Weight | 235.12 |
| InChIKey | XBZIDFOCYQIFNP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(F)cc(F)c([N+](=O)[O-])c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 125568-72-1? |
| A: Chinese name of 125568-72-1 is 125568-72-1. |
| Q: What is the InChIKey of Methyl 2,4,6-trifluoro-3-nitrobenzoate? |
| A: InChIKey of Methyl 2,4,6-trifluoro-3-nitrobenzoate is XBZIDFOCYQIFNP-UHFFFAOYSA-N. |
| Q: What is the English name of Methyl 2,4,6-trifluoro-3-nitrobenzoate? |
| A: The English name of Methyl 2,4,6-trifluoro-3-nitrobenzoate is Methyl 2,4,6-trifluoro-3-nitrobenzoate. |
| Q: What is the molecular weight of Methyl 2,4,6-trifluoro-3-nitrobenzoate? |
| A: Molecular weight of Methyl 2,4,6-trifluoro-3-nitrobenzoate is 235.12. |
| Q: What is the SMILES notation of Methyl 2,4,6-trifluoro-3-nitrobenzoate? |
| A: SMILES notation of Methyl 2,4,6-trifluoro-3-nitrobenzoate is COC(=O)c1c(F)cc(F)c([N+](=O)[O-])c1F. |
| Q: What is the CAS number of Methyl 2,4,6-trifluoro-3-nitrobenzoate? |
| A: CAS number of Methyl 2,4,6-trifluoro-3-nitrobenzoate is 125568-72-1. |
| Q: What is the molecular formula of Methyl 2,4,6-trifluoro-3-nitrobenzoate? |
| A: Molecular formula of Methyl 2,4,6-trifluoro-3-nitrobenzoate is C8H4F3NO4. |