5-Isoquinolineacetic acid, 1-chloro
Modify Date: 2026-08-26 07:43:09
5-Isoquinolineacetic acid, 1-chloro structure
|
Common Name | 5-Isoquinolineacetic acid, 1-chloro | ||
|---|---|---|---|---|
| CAS Number | 1256787-19-5 | Molecular Weight | 221.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Isoquinolineacetic acid, 1-chloro |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8ClNO2 |
|---|---|
| Molecular Weight | 221.64 |
| InChIKey | XKDHISBCZOFJGS-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc2c(Cl)nccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-Isoquinolineacetic acid, 1-chloro? |
| A: Molecular weight of 5-Isoquinolineacetic acid, 1-chloro is 221.64. |
| Q: What is the Chinese name of 1256787-19-5? |
| A: Chinese name of 1256787-19-5 is 1256787-19-5. |
| Q: What is the CAS number of 5-Isoquinolineacetic acid, 1-chloro? |
| A: CAS number of 5-Isoquinolineacetic acid, 1-chloro is 1256787-19-5. |
| Q: What is the SMILES notation of 5-Isoquinolineacetic acid, 1-chloro? |
| A: SMILES notation of 5-Isoquinolineacetic acid, 1-chloro is O=C(O)Cc1cccc2c(Cl)nccc12. |
| Q: What is the English name of 5-Isoquinolineacetic acid, 1-chloro? |
| A: The English name of 5-Isoquinolineacetic acid, 1-chloro is 5-Isoquinolineacetic acid, 1-chloro. |
| Q: What is the molecular formula of 5-Isoquinolineacetic acid, 1-chloro? |
| A: Molecular formula of 5-Isoquinolineacetic acid, 1-chloro is C11H8ClNO2. |
| Q: What is the InChIKey of 5-Isoquinolineacetic acid, 1-chloro? |
| A: InChIKey of 5-Isoquinolineacetic acid, 1-chloro is XKDHISBCZOFJGS-UHFFFAOYSA-N. |