6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl
Modify Date: 2025-08-28 11:40:20
6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl structure
|
Common Name | 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl | ||
|---|---|---|---|---|
| CAS Number | 1256788-13-2 | Molecular Weight | 191.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13NO2 |
|---|---|
| Molecular Weight | 191.23 |
| InChIKey | IAYWWAPMQNCLEG-UHFFFAOYSA-N |
| SMILES | Cc1cnc2c(c1)CC(C(=O)O)CC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl? |
| A: Molecular weight of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl is 191.23. |
| Q: What is the CAS number of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl? |
| A: CAS number of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl is 1256788-13-2. |
| Q: What is the SMILES notation of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl? |
| A: SMILES notation of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl is Cc1cnc2c(c1)CC(C(=O)O)CC2. |
| Q: What is the molecular formula of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl? |
| A: Molecular formula of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl is C11H13NO2. |
| Q: What is the Chinese name of 1256788-13-2? |
| A: Chinese name of 1256788-13-2 is 1256788-13-2. |
| Q: What is the InChIKey of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl? |
| A: InChIKey of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl is IAYWWAPMQNCLEG-UHFFFAOYSA-N. |
| Q: What is the English name of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl? |
| A: The English name of 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl is 6-Quinolinecarboxylic acid, 5,6,7,8-tetrahydro-3-methyl. |