2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine
Modify Date: 2025-09-10 08:49:48
![2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine Structure](https://www.chemsrc.com/extcaspic/010/1256822-47-5.png)
2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine structure
|
Common Name | 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 1256822-47-5 | Molecular Weight | 197.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9F2N3 |
|---|---|
| Molecular Weight | 197.18 |
| InChIKey | TVWOUFAOLBZJJW-UHFFFAOYSA-N |
| SMILES | NCC(F)(F)c1c[nH]c2ncccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine? |
| A: SMILES notation of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine is NCC(F)(F)c1c[nH]c2ncccc12. |
| Q: What is the InChIKey of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine? |
| A: InChIKey of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine is TVWOUFAOLBZJJW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine? |
| A: Molecular formula of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine is C9H9F2N3. |
| Q: What is the Chinese name of 1256822-47-5? |
| A: Chinese name of 1256822-47-5 is 1256822-47-5. |
| Q: What is the molecular weight of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine? |
| A: Molecular weight of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine is 197.18. |
| Q: What is the English name of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine? |
| A: The English name of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine is 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine. |
| Q: What is the CAS number of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine? |
| A: CAS number of 2,2-Difluoro-2-{1h-pyrrolo[2,3-b]pyridin-3-yl}ethan-1-amine is 1256822-47-5. |