3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate structure
|
Common Name | 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate | ||
|---|---|---|---|---|
| CAS Number | 1257344-59-4 | Molecular Weight | 602.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H50N4O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H50N4O8S |
|---|---|
| Molecular Weight | 602.8 |
| InChIKey | SAMORKQEZGHKQY-UHFFFAOYSA-N |
| SMILES | C[n+]1ccn(CCCCCCCCCC(=O)O)c1.C[n+]1ccn(CCCCCCCCCC(=O)O)c1.O=S(=O)([O-])[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1257344-59-4? |
| A: Chinese name of 1257344-59-4 is 1257344-59-4. |
| Q: What is the CAS number of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate? |
| A: CAS number of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate is 1257344-59-4. |
| Q: What is the molecular weight of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate? |
| A: Molecular weight of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate is 602.8. |
| Q: What is the molecular formula of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate? |
| A: Molecular formula of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate is C28H50N4O8S. |
| Q: What is the English name of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate? |
| A: The English name of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate is 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate. |
| Q: What is the SMILES notation of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate? |
| A: SMILES notation of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate is C[n+]1ccn(CCCCCCCCCC(=O)O)c1.C[n+]1ccn(CCCCCCCCCC(=O)O)c1.O=S(=O)([O-])[O-]. |
| Q: What is the InChIKey of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate? |
| A: InChIKey of 3-(9-Carboxynonyl)-1-methyl-1H-imidazol-3-ium sulfate is SAMORKQEZGHKQY-UHFFFAOYSA-N. |