copper(ii) ionophore i structure
|
Common Name | copper(ii) ionophore i | ||
|---|---|---|---|---|
| CAS Number | 125769-67-7 | Molecular Weight | 512.90100 | |
| Density | 1.084g/cm3 | Boiling Point | 574.5ºC at 760 mmHg | |
| Molecular Formula | C26H44N2S4 | Melting Point | 91-92ºC | |
| MSDS | Chinese USA | Flash Point | 301.2ºC | |
| Name | [2-[bis(2-methylpropyl)carbamothioylsulfanylmethyl]phenyl]methyl N,N-bis(2-methylpropyl)carbamodithioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 574.5ºC at 760 mmHg |
| Melting Point | 91-92ºC |
| Molecular Formula | C26H44N2S4 |
| Molecular Weight | 512.90100 |
| Flash Point | 301.2ºC |
| Exact Mass | 512.23900 |
| PSA | 121.26000 |
| LogP | 7.95080 |
| Vapour Pressure | 3.35E-13mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | JOEGUDLMKJATMX-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CC(C)C)C(=S)SCc1ccccc1CSC(=S)N(CC(C)C)CC(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
S. Kamata et al.
Analyst 114 , 1029, (1989)
|
| o-XBDiBDTC |
| Copper(II) ionophore I |
| o-Xylylenebis(N,N-diisobutyldithiocarbamate) |