[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate structure
|
Common Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate | ||
|---|---|---|---|---|
| CAS Number | 125780-97-4 | Molecular Weight | 549.66100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H39N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H39N5O5 |
|---|---|
| Molecular Weight | 549.66100 |
| Exact Mass | 549.29500 |
| PSA | 140.40000 |
| LogP | 5.75126 |
| InChIKey | FNLXKGSFJRRFGO-CSQKMGDZSA-N |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)OCC1OC(n2cc(C)c(=O)[nH]c2=O)CC1N=[N+]=[N-] |
|
~%
[(2S,3S,5R)-3-a... CAS#:125780-97-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 5 p. 1505 - 1510 |
|
~%
[(2S,3S,5R)-3-a... CAS#:125780-97-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 5 p. 1505 - 1510 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Retinoyl-AZT |
| 3'-azido-3'-deoxy-5'-O-retinoylthimidine |
| Retinoic acid analog |
| 3'-Azido-3'-deoxythymidine-retinoic acid ester |