6-amino-2-chloropurine structure
|
Common Name | 6-amino-2-chloropurine | ||
|---|---|---|---|---|
| CAS Number | 125802-42-8 | Molecular Weight | 349.81700 | |
| Density | 1.33g/cm3 | Boiling Point | 519ºC at 760mmHg | |
| Molecular Formula | C19H16ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.7ºC | |
| Name | 2-chloro-9-[(4-methylphenyl)methyl]-N-phenylpurin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 519ºC at 760mmHg |
| Molecular Formula | C19H16ClN5 |
| Molecular Weight | 349.81700 |
| Flash Point | 267.7ºC |
| Exact Mass | 349.10900 |
| PSA | 55.63000 |
| LogP | 4.65300 |
| Vapour Pressure | 7.13E-11mmHg at 25°C |
| Index of Refraction | 1.691 |
| InChIKey | OYEKUVZUFASBGC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cn2cnc3c(Nc4ccccc4)nc(Cl)nc32)cc1 |
|
~57%
6-amino-2-chlor... CAS#:125802-42-8 |
| Literature: Kelley; Linn; Selway Journal of Medicinal Chemistry, 1990 , vol. 33, # 5 p. 1360 - 1363 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-chloro-9-(4-methylbenzyl)-n-phenyl-9h-purin-6-amine |
| 6-Anilino-9-benzyl-2-chloro-9H-purines |
| ZLD0213 |
| 6-anilino-2-chloro-9-(4-methylbenzyl)-9H-purine |