9-benzyl-2-chloro-N-(4-propan-2-yloxyphenyl)purin-6-amine structure
|
Common Name | 9-benzyl-2-chloro-N-(4-propan-2-yloxyphenyl)purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 125802-47-3 | Molecular Weight | 393.86900 | |
| Density | 1.31g/cm3 | Boiling Point | 547.6ºC at 760mmHg | |
| Molecular Formula | C21H20ClN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285ºC | |
| Name | 9-benzyl-2-chloro-N-(4-propan-2-yloxyphenyl)purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 547.6ºC at 760mmHg |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.86900 |
| Flash Point | 285ºC |
| Exact Mass | 393.13600 |
| PSA | 64.86000 |
| LogP | 5.13180 |
| Vapour Pressure | 4.78E-12mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | OVWFBOCGLDRWJN-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc(Nc2nc(Cl)nc3c2ncn3Cc2ccccc2)cc1 |
|
~26%
9-benzyl-2-chlo... CAS#:125802-47-3 |
| Literature: Kelley; Linn; Selway Journal of Medicinal Chemistry, 1990 , vol. 33, # 5 p. 1360 - 1363 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9H-Purin-6-amine,2-chloro-N-[4-(1-methylethoxy)phenyl]-9-(phenylmethyl) |